C11H19NO11 — CID 175889338
2-oxopentanedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 175889338) has the molecular formula C11H19NO11 and a molecular weight of 341.27 g/mol. Its IUPAC name is 2-oxopentanedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | 2-oxopentanedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 175889338 |
| Molecular Formula | C11H19NO11 |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-oxopentanedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | NC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C6H13NO6.C5H6O5/c7-6(13)5(12)4(11)3(10)2(9)1-8;6-3(5(9)10)1-2-4(7)8/h2-5,8-12H,1H2,(H2,7,13);1-2H2,(H,7,8)(H,9,10)/t2-,3-,4+,5-;/m1./s1 |
| InChIKey | PAKXHJIJCXMFTR-JJKGCWMISA-N |
| XLogP | -4.59 |
| TPSA | 235.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|