C12H22MgO14-2 — CID 23618074
CID 23618074 (PubChem CID 23618074) has the molecular formula C12H22MgO14-2 and a molecular weight of 414.60 g/mol.
| Compound Name | CID 23618074 |
|---|---|
| PubChem CID | 23618074 |
| Molecular Formula | C12H22MgO14-2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | — |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Mg] |
| InChI | InChI=1S/2C6H12O7.Mg/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/p-2/t2*2-,3-,4+,5-;/m11./s1 |
| InChIKey | NYWLNTROMDBVAK-IYEMJOQQSA-L |
| XLogP | -10.04 |
| TPSA | 282.56 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | -10.04 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |