C7H17NO8 — CID 71587380
azanium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate (PubChem CID 71587380) has the molecular formula C7H17NO8 and a molecular weight of 243.21 g/mol. Its IUPAC name is azanium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate.
| Compound Name | azanium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
|---|---|
| PubChem CID | 71587380 |
| Molecular Formula | C7H17NO8 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | azanium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
| SMILES | O=C([O-])[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[NH4+] |
| InChI | InChI=1S/C7H14O8.H3N/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2-6,8-13H,1H2,(H,14,15);1H3/t2-,3-,4+,5-,6-;/m1./s1 |
| InChIKey | LJQUAJOUFUSZES-WYRLRVFGSA-N |
| XLogP | -5.09 |
| TPSA | 198.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | -5.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |