C14H26CaO16 — CID 28327
calcium bis((2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate) (PubChem CID 28327) has the molecular formula C14H26CaO16 and a molecular weight of 490.42 g/mol. Its IUPAC name is calcium bis((2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate).
| Compound Name | calcium bis((2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate) |
|---|---|
| PubChem CID | 28327 |
| Molecular Formula | C14H26CaO16 |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | calcium bis((2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate) |
| SMILES | O=C([O-])[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C([O-])[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Ca+2] |
| InChI | InChI=1S/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2-,3-,4+,5-,6-;/m11./s1 |
| InChIKey | FATUQANACHZLRT-XBQZYUPDSA-L |
| XLogP | -11.31 |
| TPSA | 323.02 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | -11.31 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |