C7H17NaO10 — CID 135392401
sodium;(2R,3R,4S,5R,6S)-2,3,4,5,6,7-hexahydroxyheptanoate;dihydrate (PubChem CID 135392401) has the molecular formula C7H17NaO10 and a molecular weight of 284.19 g/mol. Its IUPAC name is sodium;(2R,3R,4S,5R,6S)-2,3,4,5,6,7-hexahydroxyheptanoate;dihydrate.
| Compound Name | sodium;(2R,3R,4S,5R,6S)-2,3,4,5,6,7-hexahydroxyheptanoate;dihydrate |
|---|---|
| PubChem CID | 135392401 |
| Molecular Formula | C7H17NaO10 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | sodium;(2R,3R,4S,5R,6S)-2,3,4,5,6,7-hexahydroxyheptanoate;dihydrate |
| SMILES | O.O.O=C([O-])[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO.[Na+] |
| InChI | InChI=1S/C7H14O8.Na.2H2O/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;;;/h2-6,8-13H,1H2,(H,14,15);;2*1H2/q;+1;;/p-1/t2-,3+,4-,5+,6+;;;/m0.../s1 |
| InChIKey | JAQDQRUFGHWSGO-SPYAHKNSSA-M |
| XLogP | -10.11 |
| TPSA | 224.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | -10.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |