C6H14NNaO7 — CID 87659891
sodium;azane;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 87659891) has the molecular formula C6H14NNaO7 and a molecular weight of 235.17 g/mol. Its IUPAC name is sodium;azane;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | sodium;azane;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 87659891 |
| Molecular Formula | C6H14NNaO7 |
| Molecular Weight | 235.17 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | sodium;azane;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | N.O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Na+] |
| InChI | InChI=1S/C6H12O7.H3N.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;;/h2-5,7-11H,1H2,(H,12,13);1H3;/q;;+1/p-1/t2-,3-,4+,5-;;/m1../s1 |
| InChIKey | PMPXYGRBWAJIPS-ZBHRUSISSA-M |
| XLogP | -7.66 |
| TPSA | 176.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.17 |
| LogP ≤ 5 | -7.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |