C6H12Na2O8 — CID 174988802
disodium;2,3,4,5,6-pentahydroxyhexanoate;hydroxide (PubChem CID 174988802) has the molecular formula C6H12Na2O8 and a molecular weight of 258.13 g/mol. Its IUPAC name is disodium;2,3,4,5,6-pentahydroxyhexanoate;hydroxide.
| Compound Name | disodium;2,3,4,5,6-pentahydroxyhexanoate;hydroxide |
|---|---|
| PubChem CID | 174988802 |
| Molecular Formula | C6H12Na2O8 |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | disodium;2,3,4,5,6-pentahydroxyhexanoate;hydroxide |
| SMILES | O=C([O-])C(O)C(O)C(O)C(O)CO.[Na+].[Na+].[OH-] |
| InChI | InChI=1S/C6H12O7.2Na.H2O/c7-1-2(8)3(9)4(10)5(11)6(12)13;;;/h2-5,7-11H,1H2,(H,12,13);;;1H2/q;2*+1;/p-2 |
| InChIKey | VCXQIEYZYGNJCW-UHFFFAOYSA-L |
| XLogP | -11.00 |
| TPSA | 171.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | -11.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |