C6H11O7- — CID 5460054
(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 5460054) has the molecular formula C6H11O7- and a molecular weight of 195.15 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 5460054 |
| Molecular Formula | C6H11O7- |
| Molecular Weight | 195.15 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=C([O-])[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/p-1/t2-,3-,4+,5+/m1/s1 |
| InChIKey | RGHNJXZEOKUKBD-MBMOQRBOSA-M |
| XLogP | -4.83 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.15 |
| LogP ≤ 5 | -4.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |