C7H13CaO8+ — CID 171361211
calcium (3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate (PubChem CID 171361211) has the molecular formula C7H13CaO8+ and a molecular weight of 265.25 g/mol. Its IUPAC name is calcium (3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate.
| Compound Name | calcium (3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
|---|---|
| PubChem CID | 171361211 |
| Molecular Formula | C7H13CaO8+ |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | calcium (3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
| SMILES | O=C([O-])C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Ca+2] |
| InChI | InChI=1S/C7H14O8.Ca/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2-6,8-13H,1H2,(H,14,15);/q;+2/p-1/t2-,3-,4+,5-,6?;/m1./s1 |
| InChIKey | HUIJAXDEVNCXGM-BMZZJELJSA-M |
| XLogP | -5.85 |
| TPSA | 161.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | -5.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |