C10H16O9 — CID 54181846
4-oxo-4-[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexoxy]butanoic acid (PubChem CID 54181846) has the molecular formula C10H16O9 and a molecular weight of 280.23 g/mol. Its IUPAC name is 4-oxo-4-[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexoxy]butanoic acid.
| Compound Name | 4-oxo-4-[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexoxy]butanoic acid |
|---|---|
| PubChem CID | 54181846 |
| Molecular Formula | C10H16O9 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 4-oxo-4-[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexoxy]butanoic acid |
| SMILES | O=C(O)CCC(=O)OCC(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H16O9/c11-3-5(12)9(17)10(18)6(13)4-19-8(16)2-1-7(14)15/h5,9-12,17-18H,1-4H2,(H,14,15)/t5-,9-,10-/m1/s1 |
| InChIKey | PCJBSRAJBIZRTP-UAINPKIQSA-N |
| XLogP | -2.96 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |