C18H34O7 — CID 87072679
[(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] dodecanoate (PubChem CID 87072679) has the molecular formula C18H34O7 and a molecular weight of 362.46 g/mol. Its IUPAC name is [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] dodecanoate.
| Compound Name | [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] dodecanoate |
|---|---|
| PubChem CID | 87072679 |
| Molecular Formula | C18H34O7 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | [(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)OCC(=O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C18H34O7/c1-2-3-4-5-6-7-8-9-10-11-16(22)25-13-15(21)18(24)17(23)14(20)12-19/h14,17-20,23-24H,2-13H2,1H3/t14-,17+,18+/m1/s1 |
| InChIKey | YMQJHZNWHQUKTP-JLSDUUJJSA-N |
| XLogP | 1.09 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|