C12H24O6 — CID 163366048
(2R,3R,4S,5S)-1,2,3,4,5-pentahydroxydodecan-6-one (PubChem CID 163366048) has the molecular formula C12H24O6 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2R,3R,4S,5S)-1,2,3,4,5-pentahydroxydodecan-6-one.
| Compound Name | (2R,3R,4S,5S)-1,2,3,4,5-pentahydroxydodecan-6-one |
|---|---|
| PubChem CID | 163366048 |
| Molecular Formula | C12H24O6 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (2R,3R,4S,5S)-1,2,3,4,5-pentahydroxydodecan-6-one |
| SMILES | CCCCCCC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H24O6/c1-2-3-4-5-6-8(14)10(16)12(18)11(17)9(15)7-13/h9-13,15-18H,2-7H2,1H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | WOKWVHGFBBYBHB-DDHJBXDOSA-N |
| XLogP | -1.04 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|