C15H30O7 — CID 175836941
(2R,3R,4S,5R)-1,2,3,4,5,6-hexahydroxypentadecan-7-one (PubChem CID 175836941) has the molecular formula C15H30O7 and a molecular weight of 322.40 g/mol. Its IUPAC name is (2R,3R,4S,5R)-1,2,3,4,5,6-hexahydroxypentadecan-7-one.
| Compound Name | (2R,3R,4S,5R)-1,2,3,4,5,6-hexahydroxypentadecan-7-one |
|---|---|
| PubChem CID | 175836941 |
| Molecular Formula | C15H30O7 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (2R,3R,4S,5R)-1,2,3,4,5,6-hexahydroxypentadecan-7-one |
| SMILES | CCCCCCCCC(=O)C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H30O7/c1-2-3-4-5-6-7-8-10(17)12(19)14(21)15(22)13(20)11(18)9-16/h11-16,18-22H,2-9H2,1H3/t11-,12?,13-,14+,15+/m1/s1 |
| InChIKey | PERUQBJETFDRKD-OIYCOIKZSA-N |
| XLogP | -0.90 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|