C14H28O6 — CID 141214984
(2R,3R,4S,5R)-14-deuterio-1,2,3,4,5-pentahydroxytetradecan-6-one (PubChem CID 141214984) has the molecular formula C14H28O6 and a molecular weight of 293.38 g/mol. Its IUPAC name is (2R,3R,4S,5R)-14-deuterio-1,2,3,4,5-pentahydroxytetradecan-6-one.
| Compound Name | (2R,3R,4S,5R)-14-deuterio-1,2,3,4,5-pentahydroxytetradecan-6-one |
|---|---|
| PubChem CID | 141214984 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | (2R,3R,4S,5R)-14-deuterio-1,2,3,4,5-pentahydroxytetradecan-6-one |
| SMILES | [2H]CCCCCCCCC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H28O6/c1-2-3-4-5-6-7-8-10(16)12(18)14(20)13(19)11(17)9-15/h11-15,17-20H,2-9H2,1H3/t11-,12+,13-,14-/m1/s1/i1D |
| InChIKey | CVKSXQKLPMFGFW-DSOHOWOFSA-N |
| XLogP | -0.26 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|