C15H30O6 — CID 140874545
(2R,3R,4S,5R)-8-deuterio-1,2,3,4,5-pentahydroxypentadecan-6-one (PubChem CID 140874545) has the molecular formula C15H30O6 and a molecular weight of 307.41 g/mol. Its IUPAC name is (2R,3R,4S,5R)-8-deuterio-1,2,3,4,5-pentahydroxypentadecan-6-one.
| Compound Name | (2R,3R,4S,5R)-8-deuterio-1,2,3,4,5-pentahydroxypentadecan-6-one |
|---|---|
| PubChem CID | 140874545 |
| Molecular Formula | C15H30O6 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (2R,3R,4S,5R)-8-deuterio-1,2,3,4,5-pentahydroxypentadecan-6-one |
| SMILES | [2H]C(CCCCCCC)CC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H30O6/c1-2-3-4-5-6-7-8-9-11(17)13(19)15(21)14(20)12(18)10-16/h12-16,18-21H,2-10H2,1H3/t12-,13+,14-,15-/m1/s1/i8D/t8?,12-,13+,14-,15- |
| InChIKey | DHVINYMHFRTGMX-ZOFOPFQNSA-N |
| XLogP | 0.13 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|