C9H18O5 — CID 141072155
(2R,3S,4R)-1,2,3,4-tetrahydroxynonan-5-one (PubChem CID 141072155) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2R,3S,4R)-1,2,3,4-tetrahydroxynonan-5-one.
| Compound Name | (2R,3S,4R)-1,2,3,4-tetrahydroxynonan-5-one |
|---|---|
| PubChem CID | 141072155 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (2R,3S,4R)-1,2,3,4-tetrahydroxynonan-5-one |
| SMILES | CCCCC(=O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H18O5/c1-2-3-4-6(11)8(13)9(14)7(12)5-10/h7-10,12-14H,2-5H2,1H3/t7-,8+,9+/m1/s1 |
| InChIKey | CQAKEKFVLUSVFK-VGMNWLOBSA-N |
| XLogP | -1.18 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |