C13H22N2O6 — CID 175060803
oxalonitrile;1,2,3,4,5-pentahydroxyundecan-6-one (PubChem CID 175060803) has the molecular formula C13H22N2O6 and a molecular weight of 302.33 g/mol. Its IUPAC name is oxalonitrile;1,2,3,4,5-pentahydroxyundecan-6-one.
| Compound Name | oxalonitrile;1,2,3,4,5-pentahydroxyundecan-6-one |
|---|---|
| PubChem CID | 175060803 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | oxalonitrile;1,2,3,4,5-pentahydroxyundecan-6-one |
| SMILES | CCCCCC(=O)C(O)C(O)C(O)C(O)CO.N#CC#N |
| InChI | InChI=1S/C11H22O6.C2N2/c1-2-3-4-5-7(13)9(15)11(17)10(16)8(14)6-12;3-1-2-4/h8-12,14-17H,2-6H2,1H3; |
| InChIKey | PJRUIZWTPXKYDT-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 165.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|