C18H36O6 — CID 164775554
(2R,3R,4S,5S)-18-deuterio-1,2,3,4,5-pentahydroxyoctadecan-6-one (PubChem CID 164775554) has the molecular formula C18H36O6 and a molecular weight of 349.49 g/mol. Its IUPAC name is (2R,3R,4S,5S)-18-deuterio-1,2,3,4,5-pentahydroxyoctadecan-6-one.
| Compound Name | (2R,3R,4S,5S)-18-deuterio-1,2,3,4,5-pentahydroxyoctadecan-6-one |
|---|---|
| PubChem CID | 164775554 |
| Molecular Formula | C18H36O6 |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | (2R,3R,4S,5S)-18-deuterio-1,2,3,4,5-pentahydroxyoctadecan-6-one |
| SMILES | [2H]CCCCCCCCCCCCC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C18H36O6/c1-2-3-4-5-6-7-8-9-10-11-12-14(20)16(22)18(24)17(23)15(21)13-19/h15-19,21-24H,2-13H2,1H3/t15-,16-,17-,18-/m1/s1/i1D |
| InChIKey | RMCIOPRDYJLIQM-SBHISRMZSA-N |
| XLogP | 1.30 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|