C10H20O6 — CID 139765419
(6R,7S,8S,9R)-6,7,8,9,10-pentahydroxydecan-5-one (PubChem CID 139765419) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is (6R,7S,8S,9R)-6,7,8,9,10-pentahydroxydecan-5-one.
| Compound Name | (6R,7S,8S,9R)-6,7,8,9,10-pentahydroxydecan-5-one |
|---|---|
| PubChem CID | 139765419 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (6R,7S,8S,9R)-6,7,8,9,10-pentahydroxydecan-5-one |
| SMILES | CCCCC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H20O6/c1-2-3-4-6(12)8(14)10(16)9(15)7(13)5-11/h7-11,13-16H,2-5H2,1H3/t7-,8+,9+,10-/m1/s1 |
| InChIKey | UMUCGIKAVGXPKH-XFWSIPNHSA-N |
| XLogP | -1.82 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |