C19H38O4 — CID 87183242
(3S)-1,2,3-trihydroxynonadecan-4-one (PubChem CID 87183242) has the molecular formula C19H38O4 and a molecular weight of 330.51 g/mol. Its IUPAC name is (3S)-1,2,3-trihydroxynonadecan-4-one.
| Compound Name | (3S)-1,2,3-trihydroxynonadecan-4-one |
|---|---|
| PubChem CID | 87183242 |
| Molecular Formula | C19H38O4 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | (3S)-1,2,3-trihydroxynonadecan-4-one |
| SMILES | CCCCCCCCCCCCCCCC(=O)[C@@H](O)C(O)CO |
| InChI | InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(21)19(23)18(22)16-20/h18-20,22-23H,2-16H2,1H3/t18?,19-/m1/s1 |
| InChIKey | JDDQUGLCHBTOIL-MUMRKEEXSA-N |
| XLogP | 3.75 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|