C21H36O4 — CID 176548592
(12E,14E,16E)-1,2,3-trihydroxyhenicosa-12,14,16-trien-4-one (PubChem CID 176548592) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is (12E,14E,16E)-1,2,3-trihydroxyhenicosa-12,14,16-trien-4-one.
| Compound Name | (12E,14E,16E)-1,2,3-trihydroxyhenicosa-12,14,16-trien-4-one |
|---|---|
| PubChem CID | 176548592 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | (12E,14E,16E)-1,2,3-trihydroxyhenicosa-12,14,16-trien-4-one |
| SMILES | CCCC/C=C/C=C/C=C/CCCCCCCC(=O)C(O)C(O)CO |
| InChI | InChI=1S/C21H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(23)21(25)20(24)18-22/h5-10,20-22,24-25H,2-4,11-18H2,1H3/b6-5+,8-7+,10-9+ |
| InChIKey | RGCIKOSYKXPIMJ-SUTYWZMXSA-N |
| XLogP | 3.86 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|