C20H38O4 — CID 172757983
1,2,3-trihydroxyicos-5-en-4-one (PubChem CID 172757983) has the molecular formula C20H38O4 and a molecular weight of 342.52 g/mol. Its IUPAC name is 1,2,3-trihydroxyicos-5-en-4-one.
| Compound Name | 1,2,3-trihydroxyicos-5-en-4-one |
|---|---|
| PubChem CID | 172757983 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 1,2,3-trihydroxyicos-5-en-4-one |
| SMILES | CCCCCCCCCCCCCCC=CC(=O)C(O)C(O)CO |
| InChI | InChI=1S/C20H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(22)20(24)19(23)17-21/h15-16,19-21,23-24H,2-14,17H2,1H3 |
| InChIKey | LHEKFWQFFIZCFS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|