C17H28O5 — CID 163187831
(2S)-1,2,3,6-tetrahydroxyheptadeca-5,7,9-trien-4-one (PubChem CID 163187831) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2S)-1,2,3,6-tetrahydroxyheptadeca-5,7,9-trien-4-one.
| Compound Name | (2S)-1,2,3,6-tetrahydroxyheptadeca-5,7,9-trien-4-one |
|---|---|
| PubChem CID | 163187831 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (2S)-1,2,3,6-tetrahydroxyheptadeca-5,7,9-trien-4-one |
| SMILES | CCCCCCCC=CC=CC(O)=CC(=O)C(O)[C@@H](O)CO |
| InChI | InChI=1S/C17H28O5/c1-2-3-4-5-6-7-8-9-10-11-14(19)12-15(20)17(22)16(21)13-18/h8-12,16-19,21-22H,2-7,13H2,1H3/t16-,17?/m0/s1 |
| InChIKey | AWNPOIJMAURHDN-BHWOMJMDSA-N |
| XLogP | 2.18 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|