C25H38O4 — CID 77146427
1,2,3-trihydroxypentacosa-5,7,9,11,13,15-hexaen-4-one (PubChem CID 77146427) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 1,2,3-trihydroxypentacosa-5,7,9,11,13,15-hexaen-4-one.
| Compound Name | 1,2,3-trihydroxypentacosa-5,7,9,11,13,15-hexaen-4-one |
|---|---|
| PubChem CID | 77146427 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 1,2,3-trihydroxypentacosa-5,7,9,11,13,15-hexaen-4-one |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)C(O)C(O)CO |
| InChI | InChI=1S/C25H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(27)25(29)24(28)22-26/h10-21,24-26,28-29H,2-9,22H2,1H3 |
| InChIKey | YUQDBXCOIIGDOT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|