C23H34O — CID 123320913
tricosa-3,5,7,9,11,13-hexaen-2-one (PubChem CID 123320913) has the molecular formula C23H34O and a molecular weight of 326.52 g/mol. Its IUPAC name is tricosa-3,5,7,9,11,13-hexaen-2-one.
| Compound Name | tricosa-3,5,7,9,11,13-hexaen-2-one |
|---|---|
| PubChem CID | 123320913 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | tricosa-3,5,7,9,11,13-hexaen-2-one |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(C)=O |
| InChI | InChI=1S/C23H34O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(2)24/h11-22H,3-10H2,1-2H3 |
| InChIKey | JKAQINJKLDHKTL-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|