C17H28O — CID 167627017
(3E,5E,7E)-heptadeca-3,5,7-trien-2-one (PubChem CID 167627017) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (3E,5E,7E)-heptadeca-3,5,7-trien-2-one.
| Compound Name | (3E,5E,7E)-heptadeca-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 167627017 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (3E,5E,7E)-heptadeca-3,5,7-trien-2-one |
| SMILES | CCCCCCCCC/C=C/C=C/C=C/C(C)=O |
| InChI | InChI=1S/C17H28O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18/h11-16H,3-10H2,1-2H3/b12-11+,14-13+,16-15+ |
| InChIKey | HVLNCORMUNZHRS-UVKUXWPTSA-N |
| XLogP | 5.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|