C13H20O — CID 118922947
(3E,5E,7E)-trideca-3,5,7-trien-2-one (PubChem CID 118922947) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (3E,5E,7E)-trideca-3,5,7-trien-2-one.
| Compound Name | (3E,5E,7E)-trideca-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 118922947 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (3E,5E,7E)-trideca-3,5,7-trien-2-one |
| SMILES | CCCCC/C=C/C=C/C=C/C(C)=O |
| InChI | InChI=1S/C13H20O/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h7-12H,3-6H2,1-2H3/b8-7+,10-9+,12-11+ |
| InChIKey | XWONCSCLIGNIJF-SNUJAXHWSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|