C7H15NO8 — CID 174808782
carbamic acid;1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 174808782) has the molecular formula C7H15NO8 and a molecular weight of 241.20 g/mol. Its IUPAC name is carbamic acid;1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | carbamic acid;1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 174808782 |
| Molecular Formula | C7H15NO8 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | carbamic acid;1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | NC(=O)O.O=C(CO)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.CH3NO2/c7-1-3(9)5(11)6(12)4(10)2-8;2-1(3)4/h3,5-9,11-12H,1-2H2;2H2,(H,3,4) |
| InChIKey | YEPQSKCESAOSIA-UHFFFAOYSA-N |
| XLogP | -3.75 |
| TPSA | 181.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |