3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one

C11H22O8 — CID 174721607

IUPAC3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one
SMILESCC(C)CC(=O)O.O=C(CO)C(O)C(O)C(O)CO
InChIInChI=1S/C6H12O6.C5H10O2/c7-1-3(9)5(11)6(12)4(10)2-8;1-4(2)3-5(6)7/h3,5-9,11-12H,1-2H2;4H,3H2,1-2H3,(H,6,7)
InChIKeyXQLHMCPULIAVOD-UHFFFAOYSA-N
MW282.29 g/mol
LogP-2.26
Rot. Bonds7

About 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one

3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 174721607) has the molecular formula C11H22O8 and a molecular weight of 282.29 g/mol. Its IUPAC name is 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one.

Molecular Properties

Compound Name3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one
PubChem CID174721607
Molecular FormulaC11H22O8
Molecular Weight282.29 g/mol
Exact Mass282.13
IUPAC Name3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one
SMILESCC(C)CC(=O)O.O=C(CO)C(O)C(O)C(O)CO
InChIInChI=1S/C6H12O6.C5H10O2/c7-1-3(9)5(11)6(12)4(10)2-8;1-4(2)3-5(6)7/h3,5-9,11-12H,1-2H2;4H,3H2,1-2H3,(H,6,7)
InChIKeyXQLHMCPULIAVOD-UHFFFAOYSA-N
XLogP-2.26
TPSA155.52 Ų
H-Bond Donors6
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500282.29
LogP ≤ 5-2.26
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 107

Analyze 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one?
The IUPAC name of 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one (CID 174721607) is 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one.
What is the SMILES notation for 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one?
The canonical SMILES for 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one is CC(C)CC(=O)O.O=C(CO)C(O)C(O)C(O)CO.
What is the InChIKey of 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one?
The InChIKey is XQLHMCPULIAVOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O6.C5H10O2/c7-1-3(9)5(11)6(12)4(10)2-8;1-4(2)3-5(6)7/h3,5-9,11-12H,1-2H2;4H,3H2,1-2H3,(H,6,7).
What are the key properties of 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one?
3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one has a molecular weight of 282.29 g/mol, XLogP of -2.26, 7 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one is sourced from PubChem (CID 174721607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).