C11H22O8 — CID 174721607
3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 174721607) has the molecular formula C11H22O8 and a molecular weight of 282.29 g/mol. Its IUPAC name is 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 174721607 |
| Molecular Formula | C11H22O8 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-methylbutanoic acid;1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | CC(C)CC(=O)O.O=C(CO)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.C5H10O2/c7-1-3(9)5(11)6(12)4(10)2-8;1-4(2)3-5(6)7/h3,5-9,11-12H,1-2H2;4H,3H2,1-2H3,(H,6,7) |
| InChIKey | XQLHMCPULIAVOD-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |