C28H56O8 — CID 122611836
docosanoic acid;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 122611836) has the molecular formula C28H56O8 and a molecular weight of 520.75 g/mol. Its IUPAC name is docosanoic acid;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | docosanoic acid;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 122611836 |
| Molecular Formula | C28H56O8 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.40 |
| IUPAC Name | docosanoic acid;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)O.O=C(CO)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C22H44O2.C6H12O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;7-1-3(9)5(11)6(12)4(10)2-8/h2-21H2,1H3,(H,23,24);3,5-9,11-12H,1-2H2/t;3-,5+,6+/m.1/s1 |
| InChIKey | VFKNVXSIRVWCCR-DDRVGYBHSA-N |
| XLogP | 4.52 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|