C20H42O8 — CID 174898037
dodecanoic acid;ethene;hexane-1,2,3,4,5,6-hexol (PubChem CID 174898037) has the molecular formula C20H42O8 and a molecular weight of 410.55 g/mol. Its IUPAC name is dodecanoic acid;ethene;hexane-1,2,3,4,5,6-hexol.
| Compound Name | dodecanoic acid;ethene;hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 174898037 |
| Molecular Formula | C20H42O8 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | dodecanoic acid;ethene;hexane-1,2,3,4,5,6-hexol |
| SMILES | C=C.CCCCCCCCCCCC(=O)O.OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C12H24O2.C6H14O6.C2H4/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;7-1-3(9)5(11)6(12)4(10)2-8;1-2/h2-11H2,1H3,(H,13,14);3-12H,1-2H2;1-2H2 |
| InChIKey | MYWYPCXTMOLISR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|