C15H30O8 — CID 175934858
nonanoic acid;(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 175934858) has the molecular formula C15H30O8 and a molecular weight of 338.40 g/mol. Its IUPAC name is nonanoic acid;(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | nonanoic acid;(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 175934858 |
| Molecular Formula | C15H30O8 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | nonanoic acid;(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | CCCCCCCCC(=O)O.O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H18O2.C6H12O6/c1-2-3-4-5-6-7-8-9(10)11;7-1-3(9)5(11)6(12)4(10)2-8/h2-8H2,1H3,(H,10,11);1,3-6,8-12H,2H2/t;3-,4+,5+,6-/m.0/s1 |
| InChIKey | KPJFJCASOPRIBZ-LNEKJHARSA-N |
| XLogP | -0.56 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|