C18H32O10 — CID 174841995
4-oct-1-enoxy-4-oxobutanoic acid;2,3,4,5,6-pentahydroxyhexanal (PubChem CID 174841995) has the molecular formula C18H32O10 and a molecular weight of 408.44 g/mol. Its IUPAC name is 4-oct-1-enoxy-4-oxobutanoic acid;2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 4-oct-1-enoxy-4-oxobutanoic acid;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 174841995 |
| Molecular Formula | C18H32O10 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4-oct-1-enoxy-4-oxobutanoic acid;2,3,4,5,6-pentahydroxyhexanal |
| SMILES | CCCCCCC=COC(=O)CCC(=O)O.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C12H20O4.C6H12O6/c1-2-3-4-5-6-7-10-16-12(15)9-8-11(13)14;7-1-3(9)5(11)6(12)4(10)2-8/h7,10H,2-6,8-9H2,1H3,(H,13,14);1,3-6,8-12H,2H2 |
| InChIKey | WEHDHKVRECGWNA-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|