C41H78O9 — CID 160749337
bis((Z)-octadec-9-enoic acid);(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 160749337) has the molecular formula C41H78O9 and a molecular weight of 715.07 g/mol. Its IUPAC name is bis((Z)-octadec-9-enoic acid);(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | bis((Z)-octadec-9-enoic acid);(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 160749337 |
| Molecular Formula | C41H78O9 |
| Molecular Weight | 715.07 g/mol |
| Exact Mass | 714.56 |
| IUPAC Name | bis((Z)-octadec-9-enoic acid);(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCC/C=C\CCCCCCCC(=O)O.O=C[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/2C18H34O2.C5H10O5/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;6-1-3(8)5(10)4(9)2-7/h2*9-10H,2-8,11-17H2,1H3,(H,19,20);1,3-5,7-10H,2H2/b2*10-9-;/t;;3-,4+,5+/m..0/s1 |
| InChIKey | RWPLFRVUSREUHP-RJVAVAJOSA-N |
| XLogP | 9.48 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.07 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|