C24H46O8 — CID 174858430
(Z)-octadec-9-enoic acid;2,3,4,5,6-pentahydroxyhexanal (PubChem CID 174858430) has the molecular formula C24H46O8 and a molecular weight of 462.62 g/mol. Its IUPAC name is (Z)-octadec-9-enoic acid;2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | (Z)-octadec-9-enoic acid;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 174858430 |
| Molecular Formula | C24H46O8 |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | (Z)-octadec-9-enoic acid;2,3,4,5,6-pentahydroxyhexanal |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C18H34O2.C6H12O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;7-1-3(9)5(11)6(12)4(10)2-8/h9-10H,2-8,11-17H2,1H3,(H,19,20);1,3-6,8-12H,2H2/b10-9-; |
| InChIKey | OIJAYOZHXTXUBD-KVVVOXFISA-N |
| XLogP | 2.73 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|