C14H28O10 — CID 157169982
butanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 157169982) has the molecular formula C14H28O10 and a molecular weight of 356.37 g/mol. Its IUPAC name is butanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | butanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 157169982 |
| Molecular Formula | C14H28O10 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | butanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | CCCC(=O)O.CCCC(=O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.2C4H8O2/c7-1-3(9)5(11)6(12)4(10)2-8;2*1-2-3-4(5)6/h1,3-6,8-12H,2H2;2*2-3H2,1H3,(H,5,6)/t3-,4+,5+,6+;;/m0../s1 |
| InChIKey | ANIUNMSTSDPKKJ-FAOVPRGRSA-N |
| XLogP | -1.64 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|