About alumane;4-oct-1-enoxy-4-oxobutanoic acid
alumane;4-oct-1-enoxy-4-oxobutanoic acid (PubChem CID 173019028) has the molecular formula C12H23AlO4
and a molecular weight of 258.29 g/mol. Its IUPAC name is alumane;4-oct-1-enoxy-4-oxobutanoic acid.
Molecular Properties
| Compound Name | alumane;4-oct-1-enoxy-4-oxobutanoic acid |
| PubChem CID | 173019028 |
| Molecular Formula | C12H23AlO4 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | alumane;4-oct-1-enoxy-4-oxobutanoic acid |
| SMILES | CCCCCCC=COC(=O)CCC(=O)O.[AlH3] |
| InChI | InChI=1S/C12H20O4.Al.3H/c1-2-3-4-5-6-7-10-16-12(15)9-8-11(13)14;;;;/h7,10H,2-6,8-9H2,1H3,(H,13,14);;;; |
| InChIKey | IBVQGDIWKKHMQQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze alumane;4-oct-1-enoxy-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;4-oct-1-enoxy-4-oxobutanoic acid?
The IUPAC name of alumane;4-oct-1-enoxy-4-oxobutanoic acid (CID 173019028) is alumane;4-oct-1-enoxy-4-oxobutanoic acid.
What is the SMILES notation for alumane;4-oct-1-enoxy-4-oxobutanoic acid?
The canonical SMILES for alumane;4-oct-1-enoxy-4-oxobutanoic acid is CCCCCCC=COC(=O)CCC(=O)O.[AlH3].
What is the InChIKey of alumane;4-oct-1-enoxy-4-oxobutanoic acid?
The InChIKey is IBVQGDIWKKHMQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4.Al.3H/c1-2-3-4-5-6-7-10-16-12(15)9-8-11(13)14;;;;/h7,10H,2-6,8-9H2,1H3,(H,13,14);;;;.
What are the key properties of alumane;4-oct-1-enoxy-4-oxobutanoic acid?
alumane;4-oct-1-enoxy-4-oxobutanoic acid has a molecular weight of 258.29 g/mol, XLogP of 1.69, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;4-oct-1-enoxy-4-oxobutanoic acid is sourced from PubChem (CID 173019028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).