About 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury
4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury (PubChem CID 70400786) has the molecular formula C28H38Hg2O4
and a molecular weight of 839.79 g/mol. Its IUPAC name is 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury.
Molecular Properties
| Compound Name | 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury |
| PubChem CID | 70400786 |
| Molecular Formula | C28H38Hg2O4 |
| Molecular Weight | 839.79 g/mol |
| Exact Mass | 842.22 |
| IUPAC Name | 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury |
| SMILES | CCCCCCCCCC/C=C/OC(=O)CCC(=O)O.[Hg]c1ccccc1.[Hg]c1ccccc1 |
| InChI | InChI=1S/C16H28O4.2C6H5.2Hg/c1-2-3-4-5-6-7-8-9-10-11-14-20-16(19)13-12-15(17)18;2*1-2-4-6-5-3-1;;/h11,14H,2-10,12-13H2,1H3,(H,17,18);2*1-5H;;/b14-11+;;;; |
| InChIKey | TTWCPUDIJMWBDO-KJERPTQJSA-N |
| XLogP | 6.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 839.79 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury?
The IUPAC name of 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury (CID 70400786) is 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury.
What is the SMILES notation for 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury?
The canonical SMILES for 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury is CCCCCCCCCC/C=C/OC(=O)CCC(=O)O.[Hg]c1ccccc1.[Hg]c1ccccc1.
What is the InChIKey of 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury?
The InChIKey is TTWCPUDIJMWBDO-KJERPTQJSA-N. The full InChI is InChI=1S/C16H28O4.2C6H5.2Hg/c1-2-3-4-5-6-7-8-9-10-11-14-20-16(19)13-12-15(17)18;2*1-2-4-6-5-3-1;;/h11,14H,2-10,12-13H2,1H3,(H,17,18);2*1-5H;;/b14-11+;;;;.
What are the key properties of 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury?
4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury has a molecular weight of 839.79 g/mol, XLogP of 6.16, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-dodec-1-enoxy]-4-oxobutanoic acid;phenylmercury is sourced from PubChem (CID 70400786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).