C13H28O7 — CID 86758342
octanoic acid;(2R,4S)-pentane-1,2,3,4,5-pentol (PubChem CID 86758342) has the molecular formula C13H28O7 and a molecular weight of 296.36 g/mol. Its IUPAC name is octanoic acid;(2R,4S)-pentane-1,2,3,4,5-pentol.
| Compound Name | octanoic acid;(2R,4S)-pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 86758342 |
| Molecular Formula | C13H28O7 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | octanoic acid;(2R,4S)-pentane-1,2,3,4,5-pentol |
| SMILES | CCCCCCCC(=O)O.OC[C@@H](O)C(O)[C@@H](O)CO |
| InChI | InChI=1S/C8H16O2.C5H12O5/c1-2-3-4-5-6-7-8(9)10;6-1-3(8)5(10)4(9)2-7/h2-7H2,1H3,(H,9,10);3-10H,1-2H2/t;3-,4+,5? |
| InChIKey | RBQRIKQVLBGEFM-RWKMIERFSA-N |
| XLogP | -0.51 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|