C26H52O10 — CID 170842262
bis(decanoic acid);(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 170842262) has the molecular formula C26H52O10 and a molecular weight of 524.69 g/mol. Its IUPAC name is bis(decanoic acid);(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | bis(decanoic acid);(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 170842262 |
| Molecular Formula | C26H52O10 |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | bis(decanoic acid);(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | CCCCCCCCCC(=O)O.CCCCCCCCCC(=O)O.O=C(CO)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/2C10H20O2.C6H12O6/c2*1-2-3-4-5-6-7-8-9-10(11)12;7-1-3(9)5(11)6(12)4(10)2-8/h2*2-9H2,1H3,(H,11,12);3,5-9,11-12H,1-2H2/t;;3-,5-,6-/m..1/s1 |
| InChIKey | JFXDQTXJNPRTCN-ZKVLIJLCSA-N |
| XLogP | 3.05 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|