C25H50O8 — CID 174582302
octadecanoic acid;3,4,5,6,7-pentahydroxyheptan-2-one (PubChem CID 174582302) has the molecular formula C25H50O8 and a molecular weight of 478.67 g/mol. Its IUPAC name is octadecanoic acid;3,4,5,6,7-pentahydroxyheptan-2-one.
| Compound Name | octadecanoic acid;3,4,5,6,7-pentahydroxyheptan-2-one |
|---|---|
| PubChem CID | 174582302 |
| Molecular Formula | C25H50O8 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | octadecanoic acid;3,4,5,6,7-pentahydroxyheptan-2-one |
| SMILES | CC(=O)C(O)C(O)C(O)C(O)CO.CCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O2.C7H14O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3(9)5(11)7(13)6(12)4(10)2-8/h2-17H2,1H3,(H,19,20);4-8,10-13H,2H2,1H3 |
| InChIKey | JFEONFLNUYQAFB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|