C22H44O8 — CID 122612949
hexadecanoic acid;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 122612949) has the molecular formula C22H44O8 and a molecular weight of 436.59 g/mol. Its IUPAC name is hexadecanoic acid;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | hexadecanoic acid;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 122612949 |
| Molecular Formula | C22H44O8 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | hexadecanoic acid;(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | CCCCCCCCCCCCCCCC(=O)O.O=C(CO)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H32O2.C6H12O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;7-1-3(9)5(11)6(12)4(10)2-8/h2-15H2,1H3,(H,17,18);3,5-9,11-12H,1-2H2/t;3-,5+,6+/m.1/s1 |
| InChIKey | ALNMKPMLMUPYEC-DDRVGYBHSA-N |
| XLogP | 2.18 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|