C12H26O9 — CID 137407803
(3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one;propane-1,2,3-triol;prop-1-ene (PubChem CID 137407803) has the molecular formula C12H26O9 and a molecular weight of 314.33 g/mol. Its IUPAC name is (3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one;propane-1,2,3-triol;prop-1-ene.
| Compound Name | (3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one;propane-1,2,3-triol;prop-1-ene |
|---|---|
| PubChem CID | 137407803 |
| Molecular Formula | C12H26O9 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (3R,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-one;propane-1,2,3-triol;prop-1-ene |
| SMILES | C=CC.O=C(CO)[C@H](O)[C@@H](O)[C@H](O)CO.OCC(O)CO |
| InChI | InChI=1S/C6H12O6.C3H8O3.C3H6/c7-1-3(9)5(11)6(12)4(10)2-8;4-1-3(6)2-5;1-3-2/h3,5-9,11-12H,1-2H2;3-6H,1-2H2;3H,1H2,2H3/t3-,5+,6+;;/m1../s1 |
| InChIKey | RDGNLQRURGBNSV-BDYUXSNWSA-N |
| XLogP | -3.85 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|