C12H28O9 — CID 137407804
hexane-1,2,3,4,5,6-hexol;propane-1,2,3-triol;prop-1-ene (PubChem CID 137407804) has the molecular formula C12H28O9 and a molecular weight of 316.35 g/mol. Its IUPAC name is hexane-1,2,3,4,5,6-hexol;propane-1,2,3-triol;prop-1-ene.
| Compound Name | hexane-1,2,3,4,5,6-hexol;propane-1,2,3-triol;prop-1-ene |
|---|---|
| PubChem CID | 137407804 |
| Molecular Formula | C12H28O9 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | hexane-1,2,3,4,5,6-hexol;propane-1,2,3-triol;prop-1-ene |
| SMILES | C=CC.OCC(O)C(O)C(O)C(O)CO.OCC(O)CO |
| InChI | InChI=1S/C6H14O6.C3H8O3.C3H6/c7-1-3(9)5(11)6(12)4(10)2-8;4-1-3(6)2-5;1-3-2/h3-12H,1-2H2;3-6H,1-2H2;3H,1H2,2H3 |
| InChIKey | LPHNGAZSWTUNMW-UHFFFAOYSA-N |
| XLogP | -4.06 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|