C12H28O12 — CID 135394797
(2S,3S,4S,5S)-hexane-1,2,3,4,5,6-hexol;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol (PubChem CID 135394797) has the molecular formula C12H28O12 and a molecular weight of 364.34 g/mol. Its IUPAC name is (2S,3S,4S,5S)-hexane-1,2,3,4,5,6-hexol;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3S,4S,5S)-hexane-1,2,3,4,5,6-hexol;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 135394797 |
| Molecular Formula | C12H28O12 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (2S,3S,4S,5S)-hexane-1,2,3,4,5,6-hexol;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/2C6H14O6/c2*7-1-3(9)5(11)6(12)4(10)2-8/h2*3-12H,1-2H2/t2*3-,4-,5-,6-/m10/s1 |
| InChIKey | SWMBOMMGMHMOHE-ULDVYXPFSA-N |
| XLogP | -7.17 |
| TPSA | 242.76 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | -7.17 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |