C6H14O6Zn — CID 88619828
(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;zinc (PubChem CID 88619828) has the molecular formula C6H14O6Zn and a molecular weight of 247.56 g/mol. Its IUPAC name is (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;zinc.
| Compound Name | (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;zinc |
|---|---|
| PubChem CID | 88619828 |
| Molecular Formula | C6H14O6Zn |
| Molecular Weight | 247.56 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;zinc |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO.[Zn] |
| InChI | InChI=1S/C6H14O6.Zn/c7-1-3(9)5(11)6(12)4(10)2-8;/h3-12H,1-2H2;/t3-,4+,5-,6-;/m1./s1 |
| InChIKey | OBAMUQIVAQZOPE-VFQQELCFSA-N |
| XLogP | -3.59 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.56 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|