C7H18O6 — CID 155195650
(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;methane (PubChem CID 155195650) has the molecular formula C7H18O6 and a molecular weight of 198.21 g/mol. Its IUPAC name is (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;methane.
| Compound Name | (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;methane |
|---|---|
| PubChem CID | 155195650 |
| Molecular Formula | C7H18O6 |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;methane |
| SMILES | C.OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H14O6.CH4/c7-1-3(9)5(11)6(12)4(10)2-8;/h3-12H,1-2H2;1H4/t3-,4-,5-,6-;/m1./s1 |
| InChIKey | VSUBFWAJMZRELE-MVNLRXSJSA-N |
| XLogP | -2.95 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |