C6H19AlO7 — CID 173000212
alumane;(2S,3S,4S,5S)-hexane-1,2,3,4,5,6-hexol;hydrate (PubChem CID 173000212) has the molecular formula C6H19AlO7 and a molecular weight of 230.19 g/mol. Its IUPAC name is alumane;(2S,3S,4S,5S)-hexane-1,2,3,4,5,6-hexol;hydrate.
| Compound Name | alumane;(2S,3S,4S,5S)-hexane-1,2,3,4,5,6-hexol;hydrate |
|---|---|
| PubChem CID | 173000212 |
| Molecular Formula | C6H19AlO7 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | alumane;(2S,3S,4S,5S)-hexane-1,2,3,4,5,6-hexol;hydrate |
| SMILES | O.OC[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO.[AlH3] |
| InChI | InChI=1S/C6H14O6.Al.H2O.3H/c7-1-3(9)5(11)6(12)4(10)2-8;;;;;/h3-12H,1-2H2;;1H2;;;/t3-,4-,5-,6-;;;;;/m0...../s1 |
| InChIKey | QETPGQCLXAHPJS-JOEMKXEASA-N |
| XLogP | -5.59 |
| TPSA | 152.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | -5.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |