C7H16O7 — CID 87483282
(3R,5R,6R)-heptane-1,2,3,4,5,6,7-heptol (PubChem CID 87483282) has the molecular formula C7H16O7 and a molecular weight of 212.20 g/mol. Its IUPAC name is (3R,5R,6R)-heptane-1,2,3,4,5,6,7-heptol.
| Compound Name | (3R,5R,6R)-heptane-1,2,3,4,5,6,7-heptol |
|---|---|
| PubChem CID | 87483282 |
| Molecular Formula | C7H16O7 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (3R,5R,6R)-heptane-1,2,3,4,5,6,7-heptol |
| SMILES | OCC(O)[C@@H](O)C(O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H16O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3-14H,1-2H2/t3-,4?,5-,6-,7?/m1/s1 |
| InChIKey | OXQKEKGBFMQTML-HJPAEZFKSA-N |
| XLogP | -4.22 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |