C6H14O7 — CID 20721397
hexane-1,1,2,3,4,5,6-heptol (PubChem CID 20721397) has the molecular formula C6H14O7 and a molecular weight of 198.17 g/mol. Its IUPAC name is hexane-1,1,2,3,4,5,6-heptol.
| Compound Name | hexane-1,1,2,3,4,5,6-heptol |
|---|---|
| PubChem CID | 20721397 |
| Molecular Formula | C6H14O7 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | hexane-1,1,2,3,4,5,6-heptol |
| SMILES | OCC(O)C(O)C(O)C(O)C(O)O |
| InChI | InChI=1S/C6H14O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-13H,1H2 |
| InChIKey | WFFTZLRZZKXHJW-UHFFFAOYSA-N |
| XLogP | -4.27 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|